![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Tutorial/ | 2021-04-19 15:44 | - | |
![[ ]](/icons/layout.gif) | T3 - Install and folder structure.pdf | 2015-11-17 22:27 | 1.0M | |
| Purity III Responsive Template Docs/ | 2023-02-22 14:37 | - | |
| Noix ACL Tutorial.pdf | 2012-02-21 13:59 | 1.1M | |
| Manuale del perfetto Web Designer con Joomla (estratto).pdf | 2015-06-05 14:37 | 6.6M | |
| Manuale Joomla 1.5.pdf | 2010-02-11 14:23 | 3.4M | |
| Joomla eCommerce with VirtueMart.pdf | 2009-08-25 03:19 | 23M | |
| Joomla Template in 5 Easy Steps/ | 2021-04-19 15:43 | - | |
| Joomla 2.5 IT.pdf | 2013-11-06 01:03 | 23M | |
| Joomla 1.6 - Database Schema.pdf | 2022-10-28 10:03 | 795K | |
| Joomla 1.5 - Database Schema.pdf | 2022-10-28 10:03 | 102K | |
| Joomla - Tabella Riepilogativa Permessi Utenti.pdf | 2022-10-28 10:01 | 50K | |
| Joomla - Community Builder Api.pdf | 2011-07-07 23:44 | 1.8M | |
| Joomla! Programming - Chapter 5 (Plugins).pdf | 2015-12-30 20:07 | 8.9M | |
| Joomla! Development - A Beginner’s Guide.pdf | 2016-01-18 23:52 | 27M | |
| Joomla! Bible.pdf | 2021-05-13 13:55 | 17M | |
| Joomla! 3 SEO and Performance.pdf | 2016-01-18 23:50 | 5.8M | |
| Joomla! 3 Beginner's Guide.pdf | 2016-01-18 23:49 | 23M | |
| J3.x Access Control List Tutorial - Joomla Documentation.pdf | 2015-02-27 23:17 | 2.5M | |
| J2XML/ | 2015-12-30 21:15 | - | |
| Guida SEO Joomla.pdf | 2011-07-07 00:27 | 1.3M | |
| Artisteer 2 User Manual.pdf | 2010-04-27 17:42 | 2.1M | |
| 058_tutorial_joomlafap.pdf | 2010-04-12 16:41 | 1.8M | |
|
|---|